CAS 5873-93-8|di-(Thiobenzoyl) disulfide
Introduction:Basic information about CAS 5873-93-8|di-(Thiobenzoyl) disulfide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | di-(Thiobenzoyl) disulfide | ||
|---|---|---|---|
| CAS Number | 5873-93-8 | Molecular Weight | 306.48900 |
| Density | 1.367 g/cm3 | Boiling Point | 446.8ºC at 760 mmHg |
| Molecular Formula | C14H10S4 | Melting Point | 91 °C |
| MSDS | ChineseUSA | Flash Point | 224ºC |
| Symbol | GHS09 | Signal Word | Warning |
Names
| Name | Diphenyldithioperoxyanhydride |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.367 g/cm3 |
|---|---|
| Boiling Point | 446.8ºC at 760 mmHg |
| Melting Point | 91 °C |
| Molecular Formula | C14H10S4 |
| Molecular Weight | 306.48900 |
| Flash Point | 224ºC |
| Exact Mass | 305.96700 |
| PSA | 114.78000 |
| LogP | 5.11920 |
| InChIKey | LWGLGSPYKZTZBM-UHFFFAOYSA-N |
| SMILES | S=C(SSC(=S)c1ccccc1)c1ccccc1 |
Safety Information
| Symbol | GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H410 |
| Precautionary Statements | P273-P501 |
| Hazard Codes | N |
| Risk Phrases | 50/53 |
| Safety Phrases | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
Articles2
More Articles| Universal (switchable) RAFT agents. Material Matters 5 , 2, (2010) The polymerization of most monomers that are polymerizable by radical polymerization can be controlled by the reversible addition-fragmentation chain transfer (RAFT) process. However, it is usually re... | |
| RAFT Agent Design and Synthesis Keddie, D. J.; et al. Macromolecules 45 , 5321-5342, (2012) |
Synonyms
| diphenacylsulfone |
| dithiobenzoic acid disulfide |
| 1,1'-diphenyl-2,2'-sulfonyl-bis-ethanone |
| bis(phenacyl)sulfone |
| bis(dithiobenzoyl) disulfide |
| bis(benzoylmethyl)sulfone |
| bis(benzenethiocarbonyl) disulfide |
| bis(thiocarbonyl) disulfide |
| Diphenacyl-sulfon |
| bis(thiobenzoyl) disulfide |
| Diphenacyl sulphone |
| bis(thiobenzoyl) disulphide |
| bis(phenyl thiocarbonyl)disulfide |
| 2,2'-sulfonylbis(1-phenylethanone) |
