Introduction：Basic information about CAS 477872-94-9|2-(4-Methoxybenzyl)-1,3-thiazole-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-Methoxybenzyl)-1,3-thiazole-4-carboxylic acid |
|---|
| CAS Number | 477872-94-9 | Molecular Weight | 249.28600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H11NO3S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 2-(4-Methoxybenzyl)-1,3-thiazole-4-carboxylic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H11NO3S |
|---|
| Molecular Weight | 249.28600 |
|---|
| Exact Mass | 249.04600 |
|---|
| PSA | 87.66000 |
|---|
| LogP | 2.44070 |
|---|
| InChIKey | IKMRIOWUVVRGDM-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Cc2nc(C(=O)O)cs2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
