Introduction:Basic information about CAS 479064-91-0|Fmoc-(S)-3-Amino-3-(4-chlorophenyl)propionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-(S)-3-Amino-3-(4-chlorophenyl)propionic acid |
|---|
| CAS Number | 479064-91-0 | Molecular Weight | 421.873 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 613.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H20ClNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 324.6±31.5 °C |
|---|
Names
| Name | (3S)-3-(4-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 613.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H20ClNO4 |
|---|
| Molecular Weight | 421.873 |
|---|
| Flash Point | 324.6±31.5 °C |
|---|
| Exact Mass | 421.108093 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 5.88 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | VDMPMJZDURHZTB-QFIPXVFZSA-N |
|---|
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccc(Cl)cc1 |
|---|
Synonyms
| MFCD03427998 |
| (3S)-3-Amino-3-(4-chlorophenyl)-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid |
| (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-chlorophenyl)propanoic acid |
| D-Aspartic acid, 2-(4-chlorophenyl)-, 1-(9H-fluoren-9-ylmethyl) ester |
| (3S)-3-(4-Chlorophenyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid |
| Benzenepropanoic acid, 4-chloro-β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (βS)- |
| SC1157 |
| Fmoc-(S)-3-Amino-3-(4-chlorophenyl)propionic acid |