Introduction：Basic information about CAS 79002-96-3|5-amino-1-(2,4,6-trichlorophenyl)pyrazole-4-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-amino-1-(2,4,6-trichlorophenyl)pyrazole-4-carbonitrile |
|---|
| CAS Number | 79002-96-3 | Molecular Weight | 287.53300 |
|---|
| Density | 1.65g/cm3 | Boiling Point | 187ºC |
|---|
| Molecular Formula | C10H5Cl3N4 | Melting Point | 187-195ºC |
|---|
| MSDS | / | Flash Point | 244.6ºC |
|---|
Names
| Name | 5-amino-1-(2,4,6-trichlorophenyl)pyrazole-4-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.65g/cm3 |
|---|
| Boiling Point | 187ºC |
|---|
| Melting Point | 187-195ºC |
|---|
| Molecular Formula | C10H5Cl3N4 |
|---|
| Molecular Weight | 287.53300 |
|---|
| Flash Point | 244.6ºC |
|---|
| Exact Mass | 285.95800 |
|---|
| PSA | 67.63000 |
|---|
| LogP | 3.86758 |
|---|
| Index of Refraction | 1.714 |
|---|
| InChIKey | XLVSDPGXTLGTAE-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cnn(-c2c(Cl)cc(Cl)cc2Cl)c1N |
|---|
Synonyms
| 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole |
| 5-amino-1-(2,4,6-trichlorophenyl)-1H-pyrazole-4-carbonitrile |
