Introduction：Basic information about CAS 33295-47-5|2-Naphthalenecarboxylic acid, 4-Methoxy-, Methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Naphthalenecarboxylic acid, 4-Methoxy-, Methyl ester |
|---|
| CAS Number | 33295-47-5 | Molecular Weight | 216.23300 |
|---|
| Density | 1.166g/cm3 | Boiling Point | 349.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 145.3ºC |
|---|
Names
| Name | Methyl 4-methoxy-2-naphthoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.166g/cm3 |
|---|
| Boiling Point | 349.5ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O3 |
|---|
| Molecular Weight | 216.23300 |
|---|
| Flash Point | 145.3ºC |
|---|
| Exact Mass | 216.07900 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 2.63500 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | RDOFXDKHPHWUQW-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC)c2ccccc2c1 |
|---|
Synonyms
| 4-Methoxy-2-naphthoesaeure-methylester |
| 4-Methyloxy-2-methylbenzoic acid methyl ester |
| 4-Methoxy-2-methyl-benzoesaeure-methylester |
| 4-Methoxy-2-(methoxycarbonyl)naphthalene |
| methyl 2-methyl-4-(methyloxy)benzoate |
| Methyl-4-methoxy-2-naphthoat |
| methyl 2-methyl-4-methoxybenzoate |
| 4-methoxy-2-methylbenzoic acid methyl ester |
