Introduction：Basic information about CAS 282734-64-9|1-(Phenylsulfonyl)-2-vinyl-1H-pyrrolo[2,3-b]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(Phenylsulfonyl)-2-vinyl-1H-pyrrolo[2,3-b]pyridine |
|---|
| CAS Number | 282734-64-9 | Molecular Weight | 284.33300 |
|---|
| Density | 1.272g/cm3 | Boiling Point | 496.473ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 254.058ºC |
|---|
Names
| Name | 1-(Phenylsulfonyl)-2-vinyl-1H-pyrrolo[2,3-b]pyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.272g/cm3 |
|---|
| Boiling Point | 496.473ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12N2O2S |
|---|
| Molecular Weight | 284.33300 |
|---|
| Flash Point | 254.058ºC |
|---|
| Exact Mass | 284.06200 |
|---|
| PSA | 60.34000 |
|---|
| LogP | 3.99710 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.641 |
|---|
| InChIKey | XKTFRTZOLAQYTD-UHFFFAOYSA-N |
|---|
| SMILES | C=Cc1cc2cccnc2n1S(=O)(=O)c1ccccc1 |
|---|
Synonyms
| 1-phenylsulfonyl-2-vinyl-1H-pyrrolo[2,3-b]pyridine |
| Benzene,1-[2-(phenylsulfonyl)-1-cyclobuten-1-yl]-4-(trifluoromethyl) |
| 1-phenylsulfonyl-2-p-trifluoromethylphenyl-1-cyclobutene |
