Introduction：Basic information about CAS 348640-18-6|2-(5-Methoxy-1H-indol-3-yl)-1-tosyl-1H-pyrrolo[2,3-b]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(5-Methoxy-1H-indol-3-yl)-1-tosyl-1H-pyrrolo[2,3-b]pyridine |
|---|
| CAS Number | 348640-18-6 | Molecular Weight | 417.48000 |
|---|
| Density | 1.367g/cm3 | Boiling Point | 698.041ºC at 760 mmHg |
|---|
| Molecular Formula | C23H19N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 375.962ºC |
|---|
Names
| Name | 2-(5-Methoxy-1H-indol-3-yl)-1-[(4-methylphenyl)sulfonyl]-1H-pyrro lo[2,3-b]pyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.367g/cm3 |
|---|
| Boiling Point | 698.041ºC at 760 mmHg |
|---|
| Molecular Formula | C23H19N3O3S |
|---|
| Molecular Weight | 417.48000 |
|---|
| Flash Point | 375.962ºC |
|---|
| Exact Mass | 417.11500 |
|---|
| PSA | 85.36000 |
|---|
| LogP | 5.81940 |
|---|
| Index of Refraction | 1.69 |
|---|
| InChIKey | JGUMBSXAPVHWIQ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2[nH]cc(-c3cc4cccnc4n3S(=O)(=O)c3ccc(C)cc3)c2c1 |
|---|
Synonyms
| 2-(5-methoxy-1-benzofuran-3-yl)ethyl iodide |
| 2-(5-methoxy-1H-indol-3-yl)-1-(toluene-4-sulfonyl)-1H-pyrrolo[2,3-b]pyridine |
| Benzofuran,3-(2-iodoethyl)-5-methoxy |
