Introduction：Basic information about CAS 657-05-6|2-Chloro-5-(trifluoromethyl)benzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-5-(trifluoromethyl)benzoyl chloride |
|---|
| CAS Number | 657-05-6 | Molecular Weight | 243.010 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 235.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H3Cl2F3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 96.1±27.3 °C |
|---|
Names
| Name | 2-chloro-5-(trifluoromethyl)benzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 235.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H3Cl2F3O |
|---|
| Molecular Weight | 243.010 |
|---|
| Flash Point | 96.1±27.3 °C |
|---|
| Exact Mass | 241.951309 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.51 |
|---|
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.487 |
|---|
| InChIKey | FRARPACTAFPNNL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cc(C(F)(F)F)ccc1Cl |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | 3265 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| GVR BG EXFFF |
| 2-Chloro-5-(trifluoromethyl)benzoyl chloride |
| JRD-0979 |
| 2-chloro-5-trifluoromethylbenzoyl chloride |
| MFCD01631634 |
| 2-Chlor-5-trifluormethyl-benzoylchlorid |
| 6-Chloro-α,α,α-trifluoro-m-toluoyl chloride |
| Benzoyl chloride, 2-chloro-5-(trifluoromethyl)- |
| 2-Chlor-5-trifluormethyl-benzoesaeure-chlorid |
