Introduction:Basic information about CAS 773109-07-2|RARECHEM AL BO 1042, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | RARECHEM AL BO 1042 |
|---|
| CAS Number | 773109-07-2 | Molecular Weight | 220.26800 |
|---|
| Density | 1.194g/cm3 | Boiling Point | 393.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.6ºC |
|---|
Names
| Name | 3-(piperazin-1-ylmethyl)benzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.194g/cm3 |
|---|
| Boiling Point | 393.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16N2O2 |
|---|
| Molecular Weight | 220.26800 |
|---|
| Flash Point | 191.6ºC |
|---|
| Exact Mass | 220.12100 |
|---|
| PSA | 52.57000 |
|---|
| LogP | 1.05670 |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | UFDLFPRBJFTOCJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc(CN2CCNCC2)c1 |
|---|