Introduction：Basic information about CAS 18039-18-4|methyl 4-[2-[4-(5-methyl-2-benzoxazolyl)phenyl]vinyl]benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 4-[2-[4-(5-methyl-2-benzoxazolyl)phenyl]vinyl]benzoate |
|---|
| CAS Number | 18039-18-4 | Molecular Weight | 369.41300 |
|---|
| Density | 1.222g/cm3 | Boiling Point | 523ºC at 760mmHg |
|---|
| Molecular Formula | C24H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 270.1ºC |
|---|
Names
| Name | methyl 4-[2-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]ethenyl]benzoate |
|---|
Chemical & Physical Properties
| Density | 1.222g/cm3 |
|---|
| Boiling Point | 523ºC at 760mmHg |
|---|
| Molecular Formula | C24H19NO3 |
|---|
| Molecular Weight | 369.41300 |
|---|
| Flash Point | 270.1ºC |
|---|
| Exact Mass | 369.13600 |
|---|
| PSA | 52.33000 |
|---|
| LogP | 5.76020 |
|---|
| Vapour Pressure | 4.9E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | QQKFUTGTZXPBGA-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(C=Cc2ccc(-c3nc4cc(C)ccc4o3)cc2)cc1 |
|---|
