Introduction：Basic information about CAS 1893-52-3|2-[ethyl[(tridecafluorohexyl)sulphonyl]amino]ethyl acrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[ethyl[(tridecafluorohexyl)sulphonyl]amino]ethyl acrylate |
|---|
| CAS Number | 1893-52-3 | Molecular Weight | 525.28300 |
|---|
| Density | 1.539g/cm3 | Boiling Point | 340.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H12F13NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.7ºC |
|---|
Names
| Name | 2-[ethyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]ethyl prop-2-enoate |
|---|
Chemical & Physical Properties
| Density | 1.539g/cm3 |
|---|
| Boiling Point | 340.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H12F13NO4S |
|---|
| Molecular Weight | 525.28300 |
|---|
| Flash Point | 159.7ºC |
|---|
| Exact Mass | 525.02800 |
|---|
| PSA | 72.06000 |
|---|
| LogP | 5.14440 |
|---|
| Vapour Pressure | 8.59E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.375 |
|---|
| InChIKey | QJRQXQMZXHXNPA-UHFFFAOYSA-N |
|---|
| SMILES | C=CC(=O)OCCN(CC)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
