Introduction:Basic information about CAS 349-60-0|3,5-Bis(trifluoromethyl)anisole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-Bis(trifluoromethyl)anisole |
|---|
| CAS Number | 349-60-0 | Molecular Weight | 244.134 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 158.0±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6F6O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 55.4±23.2 °C |
|---|
Names
| Name | 1-methoxy-3,5-bis(trifluoromethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 158.0±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6F6O |
|---|
| Molecular Weight | 244.134 |
|---|
| Flash Point | 55.4±23.2 °C |
|---|
| Exact Mass | 244.032288 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 4.54 |
|---|
| Vapour Pressure | 3.5±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.391 |
|---|
| InChIKey | HQZFGUOTUIHWLR-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
|---|
Safety Information
| Hazard Codes | F: Flammable; |
|---|
| Risk Phrases | R10;R36/37/38 |
|---|
| Safety Phrases | S16 |
|---|
| RIDADR | 3271 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 3 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-Methoxy-3,5-bis(trifluoromethyl)benzene |
| MFCD00728736 |
| FXFFR CO1 EXFFF |
| 1-Methoxy-3,5-bis-trifluormethyl-benzol |
| 3,5-Bis-trifluormethyl-anisol |
| 3,5-Bis(trifluoromethyl)phenyl methyl ether |
| 5-Methoxy-1.3-bis-trifluormethyl-benzol |
| 3,5-Bis(trifluoromethyl)anisole |
| Benzene, 1-methoxy-3,5-bis(trifluoromethyl)- |
| EINECS 254-602-5 |
| 3,5-bis-trifluoromethyl-anisole |