Introduction:Basic information about CAS 3463-35-2|1,4-ditert-butyl-2-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-ditert-butyl-2-nitrobenzene |
|---|
| CAS Number | 3463-35-2 | Molecular Weight | 235.32200 |
|---|
| Density | 1.002g/cm3 | Boiling Point | 303ºC at 760 mmHg |
|---|
| Molecular Formula | C14H21NO2 | Melting Point | 88-90ºC(lit.) |
|---|
| MSDS | Chinese | Flash Point | 112.8ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1,4-ditert-butyl-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.002g/cm3 |
|---|
| Boiling Point | 303ºC at 760 mmHg |
|---|
| Melting Point | 88-90ºC(lit.) |
|---|
| Molecular Formula | C14H21NO2 |
|---|
| Molecular Weight | 235.32200 |
|---|
| Flash Point | 112.8ºC |
|---|
| Exact Mass | 235.15700 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 4.71300 |
|---|
| Index of Refraction | 1.504 |
|---|
| InChIKey | LXBUSXRSPLOXCP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c([N+](=O)[O-])c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2904209090 |
|---|
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2,5-Di-t-butylnitrobenzene |
| 1,4-di-tert-butyl-2-nitrobenzene |
| 2,5-di-tert-Butylnitrobenzene |
| 1,4-Di-tert-butyl-2-nitro-benzol |
| 2-Nitro-1,4-di-tert-butyl-benzol |