Introduction:Basic information about CAS 77737-04-3|2-amino-5-[(2-cyano-4-nitrophenyl)azo]-6-[[3-(4-hydroxybutoxy) propyl]amino]-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-amino-5-[(2-cyano-4-nitrophenyl)azo]-6-[[3-(4-hydroxybutoxy) propyl]amino]-4-methyl-3-Pyridinecarbonitrile |
|---|
| CAS Number | 77737-04-3 | Molecular Weight | 452.46600 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 767ºC at 760 mmHg |
|---|
| Molecular Formula | C21H24N8O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 417.7ºC |
|---|
Names
| Name | 2-amino-5-[(2-cyano-4-nitrophenyl)diazenyl]-6-[3-(4-hydroxybutoxy)propylamino]-4-methylpyridine-3-carbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 767ºC at 760 mmHg |
|---|
| Molecular Formula | C21H24N8O4 |
|---|
| Molecular Weight | 452.46600 |
|---|
| Flash Point | 417.7ºC |
|---|
| Exact Mass | 452.19200 |
|---|
| PSA | 201.75000 |
|---|
| LogP | 4.15656 |
|---|
| Index of Refraction | 1.645 |
|---|
| InChIKey | HUIWEWMNRIAEOB-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(C#N)c(N)nc(NCCCOCCCCO)c1N=Nc1ccc([N+](=O)[O-])cc1C#N |
|---|