Introduction:Basic information about CAS 82358-31-4|Coelogin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Coelogin |
|---|
| CAS Number | 82358-31-4 | Molecular Weight | 300.30600 |
|---|
| Density | 1.407g/cm3 | Boiling Point | 562.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H16O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 294.1ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.407g/cm3 |
|---|
| Boiling Point | 562.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H16O5 |
|---|
| Molecular Weight | 300.30600 |
|---|
| Flash Point | 294.1ºC |
|---|
| Exact Mass | 300.10000 |
|---|
| PSA | 68.15000 |
|---|
| LogP | 2.77300 |
|---|
| Index of Refraction | 1.674 |
|---|
| InChIKey | QLYYIQVXUQYKGV-UHFFFAOYSA-N |
|---|
| SMILES | COc1c(O)c2c3c(c1OC)CCc1cc(O)cc(c1-3)OC2 |
|---|