Introduction：Basic information about CAS 34586-27-1|1-(1-BENZOTHIOPHEN-2-YL)-2-BROMO-1-ETHANONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(1-BENZOTHIOPHEN-2-YL)-2-BROMO-1-ETHANONE |
|---|
| CAS Number | 34586-27-1 | Molecular Weight | 185.60800 |
|---|
| Density | 1.269g/cm3 | Boiling Point | 261.904ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 112.196ºC |
|---|
Names
| Name | 1-(1-chloroethyl)-3-nitrobenzene |
|---|
Chemical & Physical Properties
| Density | 1.269g/cm3 |
|---|
| Boiling Point | 261.904ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8ClNO2 |
|---|
| Molecular Weight | 185.60800 |
|---|
| Flash Point | 112.196ºC |
|---|
| Exact Mass | 185.02400 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.41780 |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | QRWUNNJGVSGUAF-UHFFFAOYSA-N |
|---|
| SMILES | CC(Cl)c1cccc([N+](=O)[O-])c1 |
|---|
