Introduction:Basic information about CAS 497-75-6|dioxethedrin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dioxethedrin |
|---|
| CAS Number | 497-75-6 | Molecular Weight | 211.25800 |
|---|
| Density | 1.199g/cm3 | Boiling Point | 417.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H17NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 179.7ºC |
|---|
Names
| Name | 4-[2-(ethylamino)-1-hydroxypropyl]benzene-1,2-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.199g/cm3 |
|---|
| Boiling Point | 417.5ºC at 760mmHg |
|---|
| Molecular Formula | C11H17NO3 |
|---|
| Molecular Weight | 211.25800 |
|---|
| Flash Point | 179.7ºC |
|---|
| Exact Mass | 211.12100 |
|---|
| PSA | 72.72000 |
|---|
| LogP | 1.52010 |
|---|
| Vapour Pressure | 1.02E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | OHDICGSRVLBVLC-UHFFFAOYSA-N |
|---|
| SMILES | CCNC(C)C(O)c1ccc(O)c(O)c1 |
|---|
Synonyms
| Dioxethedrinum |
| Dioxetedrina |
| Dioxethedrine |
| Dioxethedrin |