Introduction：Basic information about CAS 5863-44-5|2,4-bis(2,4-xylylazo)resorcinol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-bis(2,4-xylylazo)resorcinol |
|---|
| CAS Number | 5863-44-5 | Molecular Weight | 374.43600 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 526.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H22N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 272.1ºC |
|---|
Names
| Name | (2E,6Z)-2,6-bis[(2,4-dimethylphenyl)hydrazinylidene]cyclohex-4-ene-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 526.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H22N4O2 |
|---|
| Molecular Weight | 374.43600 |
|---|
| Flash Point | 272.1ºC |
|---|
| Exact Mass | 374.17400 |
|---|
| PSA | 82.92000 |
|---|
| LogP | 4.01020 |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | JTHUBMQPODORFF-NRTBZSEMSA-N |
|---|
| SMILES | Cc1ccc(NN=c2ccc(=O)c(=NNc3ccc(C)cc3C)c2=O)c(C)c1 |
|---|
Synonyms
| 1,3-Benzenediol,2,4-bis((2,4-dimethylphenyl)azo) |
| 2,4-Bis(2,4-xylylazo)resorcinol |
| EINECS 227-510-8 |
| 1,3-Benzenediol,2,4-bis(2-(2,4-dimethylphenyl)diazenyl) |
