Introduction：Basic information about CAS 34009-61-5|Diethyl methyl(phenyl)malonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diethyl methyl(phenyl)malonate |
|---|
| CAS Number | 34009-61-5 | Molecular Weight | 250.290 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 315.8±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 148.5±20.7 °C |
|---|
Names
| Name | diethyl 2-methyl-2-phenylpropanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 315.8±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18O4 |
|---|
| Molecular Weight | 250.290 |
|---|
| Flash Point | 148.5±20.7 °C |
|---|
| Exact Mass | 250.120514 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.06 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.494 |
|---|
| InChIKey | KGUIOHXCGVQYEG-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C)(C(=O)OCC)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Methyl-phenyl-malonsaeure-diaethylester |
| diethyl 2-methyl-2-phenylmalonate |
| methyl-phenyl-malonic acid diethyl ester |
| EINECS 251-789-5 |
| 2-methyl-2-phenylmalonic acid diethyl ester |
| Diethyl methyl(phenyl)malonate |
| Propanedioic acid, 2-methyl-2-phenyl-, diethyl ester |
| DIETHYL METHYLPHENYLMALONATE |
| diethyl 2-phenyl-2-methylmalonate |
