Introduction：Basic information about CAS 5807-64-7|[1,1'-Biphenyl]-2,2'-dicarboxylicacid, 2,2'-dimethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [1,1'-Biphenyl]-2,2'-dicarboxylicacid, 2,2'-dimethyl ester |
|---|
| CAS Number | 5807-64-7 | Molecular Weight | 270.28000 |
|---|
| Density | 1.172g/cm3 | Boiling Point | 423.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 215.1ºC |
|---|
Names
| Name | methyl 2-(2-methoxycarbonylphenyl)benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.172g/cm3 |
|---|
| Boiling Point | 423.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O4 |
|---|
| Molecular Weight | 270.28000 |
|---|
| Flash Point | 215.1ºC |
|---|
| Exact Mass | 270.08900 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.92680 |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | CGTYPNOFVGYUED-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccccc1-c1ccccc1C(=O)OC |
|---|
Synonyms
| Dimethyl 2,2'-biphenyldicarboxylate |
| biphenyl-2,2'-dicarboxylic acid dimethyl ester |
| Diphenic acid,dimethyl ester |
| dimethyl biphenyl-2,2'-dicarboxylate |
| 2,2'-bibenzoic acid dimethyl ester |
| Biphenyl-2,2'-dicarboxylic acid dim |
