Introduction：Basic information about CAS 649761-21-7|(1R,5S)-5-(Dimethylphenylsilyl)-2-(hydroxymethyl)-2-cyclopentene-1-carboxylic, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R,5S)-5-(Dimethylphenylsilyl)-2-(hydroxymethyl)-2-cyclopentene-1-carboxylic acid |
|---|
| CAS Number | 649761-21-7 | Molecular Weight | 276.40300 |
|---|
| Density | 1.14 | Boiling Point | 433.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (1R,5S)-5-(Dimethylphenylsilyl)-2-(hydroxymethyl)-2-cyclopentene-1-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.14 |
|---|
| Boiling Point | 433.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20O3Si |
|---|
| Molecular Weight | 276.40300 |
|---|
| Exact Mass | 276.11800 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 1.99540 |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | FHOHJSKIYDHHOL-KBPBESRZSA-N |
|---|
| SMILES | C[Si](C)(c1ccccc1)C1CC=C(CO)C1C(=O)O |
|---|
