Introduction：Basic information about CAS 78902-09-7|2-(2,2-Diethoxyethyl)-1H-isoindole-1,3(2H)-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2,2-Diethoxyethyl)-1H-isoindole-1,3(2H)-dione |
|---|
| CAS Number | 78902-09-7 | Molecular Weight | 263.289 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 372.3±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H17NO4 | Melting Point | 72-74 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 179.0±25.1 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | phthalimidoacetaldehyde diethyl acetal |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 372.3±32.0 °C at 760 mmHg |
|---|
| Melting Point | 72-74 °C(lit.) |
|---|
| Molecular Formula | C14H17NO4 |
|---|
| Molecular Weight | 263.289 |
|---|
| Flash Point | 179.0±25.1 °C |
|---|
| Exact Mass | 263.115753 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 3.11 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.541 |
|---|
| InChIKey | GEFXJJJQUSEHLV-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(CN1C(=O)c2ccccc2C1=O)OCC |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2925190090 |
|---|
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| phthalimido-acetaldehyde hydrate |
| 1H-Isoindole-1,3(2H)-dione, 2-(2,2-diethoxyethyl)- |
| phthalimidoacetaldehyde diethylacetal |
| 2-(2,2-Diethoxyethyl)-1H-isoindole-1,3(2H)-dione |
| N-phthalimido aminoacetaldehyde diethyl acetal |
| 2-(2,2-diethoxyethyl)isoindoline-1,3-dione |
| MFCD00005901 |
| 2-Phthalimidylacetaldehyde diethyl acetal |
| 2-(Phthalimido)acetaldehyde diethylacetal |
| N-(2,2-DIETHOXYETHYL)PHTHALIMIDE |
