Introduction：Basic information about CAS 4741-53-1|4,5,6,7-tetraphenylisobenzofuran-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,5,6,7-tetraphenylisobenzofuran-1,3-dione |
|---|
| CAS Number | 4741-53-1 | Molecular Weight | 452.49900 |
|---|
| Density | 1.244g/cm3 | Boiling Point | 596ºC at 760 mmHg |
|---|
| Molecular Formula | C32H20O3 | Melting Point | 293-297ºC |
|---|
| MSDS | / | Flash Point | 290.4ºC |
|---|
Names
| Name | 4,5,6,7-tetraphenyl-2-benzofuran-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.244g/cm3 |
|---|
| Boiling Point | 596ºC at 760 mmHg |
|---|
| Melting Point | 293-297ºC |
|---|
| Molecular Formula | C32H20O3 |
|---|
| Molecular Weight | 452.49900 |
|---|
| Flash Point | 290.4ºC |
|---|
| Exact Mass | 452.14100 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 7.66520 |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | RSKXGCFFFZIWNC-UHFFFAOYSA-N |
|---|
| SMILES | O=C1OC(=O)c2c1c(-c1ccccc1)c(-c1ccccc1)c(-c1ccccc1)c2-c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
Synonyms
| 4,5,6,7-tetraphenylisobenzofuran-1,3-dione |
| Tetraphenylphthalic anhydride |
| EINECS 225-253-6 |
| 3,4,5,6-tetraphenylphthalic acid anhydride |
| Tetraphenyl-phthalsaeureanhydrid |
| MFCD00044504 |
| tetraphenyl-phthalic acid anhydride |
