Introduction：Basic information about CAS 77977-73-2|(r)-4-nitromandelic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (r)-4-nitromandelic acid |
|---|
| CAS Number | 77977-73-2 | Molecular Weight | 197.14500 |
|---|
| Density | 1.552g/cm3 | Boiling Point | 436.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.6ºC |
|---|
Names
| Name | (r)-4-nitromandelic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.552g/cm3 |
|---|
| Boiling Point | 436.4ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7NO5 |
|---|
| Molecular Weight | 197.14500 |
|---|
| Flash Point | 197.6ºC |
|---|
| Exact Mass | 197.03200 |
|---|
| PSA | 103.35000 |
|---|
| LogP | 1.23600 |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | ZSMJZVLXJDNZHG-SSDOTTSWSA-N |
|---|
| SMILES | O=C(O)C(O)c1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-nitro-D-mandelic acid |
| 4-Nitro-D-mandelsaeure |
