Introduction：Basic information about CAS 345-89-1|4-fluoro-4'-methoxybenzophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-fluoro-4'-methoxybenzophenone |
|---|
| CAS Number | 345-89-1 | Molecular Weight | 230.234 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 351.4±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H11FO2 | Melting Point | 90-92ºC |
|---|
| MSDS | USA | Flash Point | 160.7±18.6 °C |
|---|
Names
| Name | (4-fluorophenyl)-(4-methoxyphenyl)methanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 351.4±27.0 °C at 760 mmHg |
|---|
| Melting Point | 90-92ºC |
|---|
| Molecular Formula | C14H11FO2 |
|---|
| Molecular Weight | 230.234 |
|---|
| Flash Point | 160.7±18.6 °C |
|---|
| Exact Mass | 230.074310 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.45 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | VWGWRNBIAWTWIB-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)c2ccc(F)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2914700090 |
|---|
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| (4-Fluorophenyl)(4-methoxyphenyl)methanone |
| 4-Fluor-4'-methoxy-benzophenon |
| EINECS 206-464-2 |
| (4-Fluoro-phenyl)(4-methoxyphenyl)methanone |
| (4-fluorophenyl)(4-methoxyphenyl)ketone |
| (4-fluorophenyl)-(4-methoxyphenyl)-methanone |
| Methanone, (4-fluorophenyl)(4-methoxyphenyl)- |
| 4-fluoro-4'-methoxybenzophenone |
| MFCD00055469 |
| (4-fluorphenyl)(4-methoxyphenyl)methanon |
