Introduction：Basic information about CAS 635-84-7|p-phenylphenacyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-phenylphenacyl chloride |
|---|
| CAS Number | 635-84-7 | Molecular Weight | 230.689 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 366.1±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H11ClO | Melting Point | 126°C |
|---|
| MSDS | / | Flash Point | 197.9±12.1 °C |
|---|
Names
| Name | 2-Chloro-4'-phenylacetophenone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 366.1±17.0 °C at 760 mmHg |
|---|
| Melting Point | 126°C |
|---|
| Molecular Formula | C14H11ClO |
|---|
| Molecular Weight | 230.689 |
|---|
| Flash Point | 197.9±12.1 °C |
|---|
| Exact Mass | 230.049850 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.69 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | IQEIGQFNDLINOT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CCl)c1ccc(-c2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2914700090 |
|---|
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-(biphenyl-4-yl)-2-chloroethanone |
| p-phenylphenacyl chloride |
| 1-(4-Biphenylyl)-2-chloroethanone |
| 2-chloro-1-(4-phenylphenyl)ethan-1-one |
| Ethanone, 1-[1,1'-biphenyl]-4-yl-2-chloro- |
| 1-Biphenyl-4-yl-2-chloro-ethanone |
| 2-chloro-1-(4-phenylphenyl)ethanone |
| 2-Chloro-4'-phenylacetophenone |
| Ethanone, 1-(1,1'-biphenyl)-4-yl-2-chloro- |
| MFCD00058937 |
| 1-(Biphenyl-4-yl)-2-chlorethanon |
