Introduction:Basic information about CAS 18422-53-2|1,2:4,5-di-o-isopropylidene-beta-d-erythro-2,3-hexodiulo-2,6-pyranose, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2:4,5-di-o-isopropylidene-beta-d-erythro-2,3-hexodiulo-2,6-pyranose |
|---|
| CAS Number | 18422-53-2 | Molecular Weight | 258.26800 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 341.9ºC at 760mmHg |
|---|
| Molecular Formula | C12H18O6 | Melting Point | 102-104ºC |
|---|
| MSDS | / | Flash Point | 150ºC |
|---|
Names
| Name | (3'aR,4S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 341.9ºC at 760mmHg |
|---|
| Melting Point | 102-104ºC |
|---|
| Molecular Formula | C12H18O6 |
|---|
| Molecular Weight | 258.26800 |
|---|
| Flash Point | 150ºC |
|---|
| Exact Mass | 258.11000 |
|---|
| PSA | 63.22000 |
|---|
| LogP | 0.58500 |
|---|
| Vapour Pressure | 7.81E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.511 |
|---|
| InChIKey | IVWWFWFVSWOTLP-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OC2COC3(COC(C)(C)O3)C(=O)C2O1 |
|---|
| Storage condition | 2-8°C |
|---|
| Water Solubility | Soluble in chloroform and methanol. |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| MFCD00063383 |
| Shi's ketone |
| Shi's catalyst |
| diketal Shi-catalyst |
| Shi epoxidation catalist |
| Shi Epoxidation Diketal Catalyst |
| D-Epoxone |
| Shi's epoxone |
| Shi catalyst |