Introduction：Basic information about CAS 792893-05-1|(2S)-2-[(1,1-dioxothiolan-3-yl)amino]-4-methylpentanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2S)-2-[(1,1-dioxothiolan-3-yl)amino]-4-methylpentanoic acid |
|---|
| CAS Number | 792893-05-1 | Molecular Weight | 249.32700 |
|---|
| Density | 1.25g/cm3 | Boiling Point | 470.4ºC at 760 mmHg |
|---|
| Molecular Formula | C10H19NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 238.3ºC |
|---|
Names
| Name | (2S)-2-[(1,1-dioxothiolan-3-yl)amino]-4-methylpentanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Boiling Point | 470.4ºC at 760 mmHg |
|---|
| Molecular Formula | C10H19NO4S |
|---|
| Molecular Weight | 249.32700 |
|---|
| Flash Point | 238.3ºC |
|---|
| Exact Mass | 249.10300 |
|---|
| PSA | 91.85000 |
|---|
| LogP | 1.73410 |
|---|
| Index of Refraction | 1.517 |
|---|
| InChIKey | TVGAJMRKHDUNPB-GKAPJAKFSA-N |
|---|
| SMILES | CC(C)CC(NC1CCS(=O)(=O)C1)C(=O)O |
|---|
Safety Information
