Introduction:Basic information about CAS 3353-69-3|ethane-1,2-diylbis(dichloromethylsilane), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethane-1,2-diylbis(dichloromethylsilane) |
|---|
| CAS Number | 3353-69-3 | Molecular Weight | 256.105 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 209.9±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C4H10Cl4Si2 | Melting Point | 33-35ºC(lit.) |
|---|
| MSDS | / | Flash Point | 79.9±14.6 °C |
|---|
Names
| Name | 1,2-bis(dichloromethylsilyl)ethane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 209.9±13.0 °C at 760 mmHg |
|---|
| Melting Point | 33-35ºC(lit.) |
|---|
| Molecular Formula | C4H10Cl4Si2 |
|---|
| Molecular Weight | 256.105 |
|---|
| Flash Point | 79.9±14.6 °C |
|---|
| Exact Mass | 253.907516 |
|---|
| LogP | 6.46 |
|---|
| Appearance of Characters | solid |
|---|
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.455 |
|---|
| InChIKey | VFURVLVRHAMJKG-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](Cl)(Cl)CC[Si](C)(Cl)Cl |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-28-36/37/39-45 |
|---|
| RIDADR | UN 2987 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 1,2-bis(dichloromethylsily)ethane |
| Ethylenebis(methyldichlorosilane) |
| Silane,1,2-ethanediylbis[dichloromethyl |
| ethane-1,2-diylbis(dichloromethylsilane) |
| 1,2-bis(dichloro(methyl)silyl)ethane |
| 1,2-ethanediylbis[dichloromethyl-Silane |
| Silane, 1,2-ethanediylbis[dichloromethyl- |
| Silane, 1,1'-(1,2-ethanediyl)bis[1,1-dichloro-1-methyl- |
| 1,2-Ethanediylbis[dichloro(methyl)silane] |
| 1,2-ethanediylbis[dichloromethyl-silan |
| Bis(1,2-methyldichlorosilyl)ethane |
| EINECS 222-123-0 |
| bis(methyldichlorosilyl)ethane |
| 1,2-BIS(METHYLDICHLOROSILYL)ETHANE |
| Ethane-1,2-diylbis[dichloro(methyl)silane] |
| ethylenebis(dichloromethylsilane) |
| 2,2,5,5-tetrachloro-2,5-disilahexane |