Introduction：Basic information about CAS 1817-67-0|Phenol,4-methyl-2-(1-phenylethyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol,4-methyl-2-(1-phenylethyl)- |
|---|
| CAS Number | 1817-67-0 | Molecular Weight | 212.28700 |
|---|
| Density | 1.057g/cm3 | Boiling Point | 328.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 155.3ºC |
|---|
Names
| Name | 4-methyl-2-(1-phenyl-ethyl)-phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.057g/cm3 |
|---|
| Boiling Point | 328.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16O |
|---|
| Molecular Weight | 212.28700 |
|---|
| Flash Point | 155.3ºC |
|---|
| Exact Mass | 212.12000 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 3.85240 |
|---|
| Vapour Pressure | 9.64E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | DJRYJQNZAYJVGF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(O)c(C(C)c2ccccc2)c1 |
|---|
Synonyms
| (+-)-4-Methyl-2-(1-phenyl-aethyl)-phenol |
| 4-methyl-2-(1-phenylethyl)phenol |
| 4-methyl-2-(trimethylsilyl)phenyl tiflate |
| 4-methyl-2-(trimethylsilyl)phenyl trifluoromethanesulfonate |
| 2-trimethylsilyl-4-methylphenyl triflate |
| 6-(ALPHA-METHYLBENZYL)-2,4-XYLENOL |
| 4-Methyl-2-(trimethylsilyl)phenyl Triflate |
