Introduction:Basic information about CAS 28620-12-4|6-Nitro-benzothiazol-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Nitro-benzothiazol-2-one |
|---|
| CAS Number | 28620-12-4 | Molecular Weight | 196.183 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 468.1ºC at 760 mmHg |
|---|
| Molecular Formula | C7H4N2O3S | Melting Point | 246 °C (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | 236.9ºC |
|---|
Names
| Name | 6-nitro-3H-1,3-benzothiazol-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 468.1ºC at 760 mmHg |
|---|
| Melting Point | 246 °C (dec.)(lit.) |
|---|
| Molecular Formula | C7H4N2O3S |
|---|
| Molecular Weight | 196.183 |
|---|
| Flash Point | 236.9ºC |
|---|
| Exact Mass | 195.994263 |
|---|
| PSA | 106.92000 |
|---|
| LogP | 1.49 |
|---|
| Vapour Pressure | 2.19E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.702 |
|---|
| InChIKey | QITPMSSAFSZYOP-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c2ccc([N+](=O)[O-])cc2s1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934200090 |
|---|
Customs
| HS Code | 2934200090 |
|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2(3H)-Benzothiazolone,6-nitro |
| F1930-0018 |
| 6-nitrobenzothiazolin-2-one |
| 6-Nitro-2,3-dihydro-1,3-benzothiazol-2-one |
| 6-Nitro-1,3-benzothiazol-2(3H)-one |
| MFCD00239350 |
| 6-nitro-2(3H)-benzthiazolone |
| 6-Nitrobenzo[d]thiazol-2(3H)-one |
| 6-Nitro-2(3H)-benzothiazolone |
| 6-Nitro-2-benzothiazolinone |
| 6-nitrobenzothiazol-2(3H)-one |
| 6-nitro-3H-benzothiazol-2-one |
| 6-Nitro-benzothiazol-2-one |
| 6-Nitro-3H-benzothiazol-2-on |
| 2(3H)-Benzothiazolone, 6-nitro- |
| 6-nitrobenzothiazol-2-ol |
| 6-nitro-1,3-benzothiazol-2-ol |