Introduction:Basic information about CAS 4906-22-3|4-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2,6-dimethylcyclohexa-2,5-di, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one |
|---|
| CAS Number | 4906-22-3 | Molecular Weight | 240.29700 |
|---|
| Density | 1.123g/cm3 | Boiling Point | 375.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O2 | Melting Point | 205-207ºC |
|---|
| MSDS | / | Flash Point | 140.7ºC |
|---|
Names
| Name | 4-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.123g/cm3 |
|---|
| Boiling Point | 375.1ºC at 760 mmHg |
|---|
| Melting Point | 205-207ºC |
|---|
| Molecular Formula | C16H16O2 |
|---|
| Molecular Weight | 240.29700 |
|---|
| Flash Point | 140.7ºC |
|---|
| Exact Mass | 240.11500 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 3.23360 |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | QDRFIDSUGRGGAY-UHFFFAOYSA-N |
|---|
| SMILES | CC1=CC(=C2C=C(C)C(=O)C(C)=C2)C=C(C)C1=O |
|---|
Safety Information
Customs
| HS Code | 2914299000 |
|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| 3,5,3',5'-tetramethyl-4,4'-diphenoquinone |
| (Bi-2,5-cyclohexadien-1-ylidene)-4,4'-dione,3,3',5,5'-tetramethyl |
| Tetramethyldiphenoquinone |
| 3,3',5,5'-Tetramethyldiphenoquinone |
| 2,6,2',6'-tetramethyldiphenoquinone |
| 3,3',5,5'-tetramethyl-1,1'-bi(cyclohexa-2,5-dien-1-ylidene)-4,4'-dione |
| 3,3',5,5'-tetramethyl-1,4-diphenoquinone |
| 3,3',5,5'-Tetramethyl-4,4'-diphenoquinone |
| 2,5-Cyclohexadien-1-one,4-(3,5-dimethyl-4-oxo-2,5-cyclohexadien-1-ylidene)-2,6-dimethyl |
| 4-(3,5-dimethyl-4-oxo-2,5-cyclohexadienylidene)-2,6-dimethyl-2,5-cyclohexadienone |