Introduction：Basic information about CAS 348-19-6|2'-FLUORO-4'-NITROACETANILID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2'-FLUORO-4'-NITROACETANILID |
|---|
| CAS Number | 348-19-6 | Molecular Weight | 198.15100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H7FN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N-(2-fluoro-4-nitrophenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H7FN2O3 |
|---|
| Molecular Weight | 198.15100 |
|---|
| Exact Mass | 198.04400 |
|---|
| PSA | 74.92000 |
|---|
| LogP | 2.28850 |
|---|
| InChIKey | KFSFGCHQQCRZBB-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])cc1F |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 6-fluoro-4-nitroacetanilide |
| 4-nitro-2-fluoroacetanilide |
| acetic acid-(2-fluoro-4-nitro-anilide) |
| VT1112 |
| 2-Fluor-4-nitro-acetanilid |
| Essigsaeure-(2-fluor-4-nitro-anilid) |
| 2'-fluoro-4'-nitroacetanilide |
