Introduction：Basic information about CAS 6342-72-9|2-Hydroxyterephthalic acid dimethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Hydroxyterephthalic acid dimethyl ester |
|---|
| CAS Number | 6342-72-9 | Molecular Weight | 210.18300 |
|---|
| Density | 1.284g/cm3 | Boiling Point | 327.6ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10O5 | Melting Point | 92-93℃ |
|---|
| MSDS | / | Flash Point | 127.9ºC |
|---|
Names
| Name | dimethyl 2-hydroxybenzene-1,4-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.284g/cm3 |
|---|
| Boiling Point | 327.6ºC at 760 mmHg |
|---|
| Melting Point | 92-93℃ |
|---|
| Molecular Formula | C10H10O5 |
|---|
| Molecular Weight | 210.18300 |
|---|
| Flash Point | 127.9ºC |
|---|
| Exact Mass | 210.05300 |
|---|
| PSA | 72.83000 |
|---|
| LogP | 0.96540 |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | CJOJIAKIRLKBOO-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(C(=O)OC)c(O)c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2918199090 |
|---|
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| hydroxy-terephthalic acid dimethyl ester |
| hydroxy dimethyl terephthalate |
| Hydroxy-terephthalsaeure-dimethylester |
| dimethyl 2-hydroxyterephthalate |
| 2-Hydroxyterephthalsaeure-dimethylester |
| 2-hydroxyterephthalic acid dimethyl ester |
