Introduction：Basic information about CAS 4774-73-6|Dimethylsilanediyl diacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dimethylsilanediyl diacetate |
|---|
| CAS Number | 4774-73-6 | Molecular Weight | 176.243 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 165.0±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H12O4Si | Melting Point | -12.5ºC(lit.) |
|---|
| MSDS | / | Flash Point | 44.7±14.3 °C |
|---|
Names
| Name | diazido(dimethyl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 165.0±9.0 °C at 760 mmHg |
|---|
| Melting Point | -12.5ºC(lit.) |
|---|
| Molecular Formula | C6H12O4Si |
|---|
| Molecular Weight | 176.243 |
|---|
| Flash Point | 44.7±14.3 °C |
|---|
| Exact Mass | 176.050491 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 1.30 |
|---|
| Vapour Pressure | 1.9±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.409 |
|---|
| InChIKey | QYNWVPNBQDQHJF-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(N=[N+]=[N-])N=[N+]=[N-] |
|---|
| Storage condition | 2~8℃，Seal |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | 34 |
|---|
| RIDADR | UN 3265 8/PG 3 |
|---|
Synonyms
| Dimethylsilanediyl diacetate |
| Silanediol, 1,1-dimethyl-, diacetate |
| EINECS 225-318-9 |
| Silane,diazidodimethyl |
| Silanediol, dimethyl-, diacetate |
| Di-azido-dimethyl-silan |
| Dimethyldiazidosilane |
| Diazidodimethylsilane |
| dimethylsilyl diazide |
| Dimethyl-diazido-silan |
| Diacetoxy Dimethylsilane |
