Introduction：Basic information about CAS 7144-89-0|Propane,2-[[[(1,1-dimethylethyl)sulfonyl]methyl]sulfonyl]-2-methyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Propane,2-[[[(1,1-dimethylethyl)sulfonyl]methyl]sulfonyl]-2-methyl- |
|---|
| CAS Number | 7144-89-0 | Molecular Weight | 256.38300 |
|---|
| Density | 1.169g/cm3 | Boiling Point | 438.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H20O4S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 271.1ºC |
|---|
Names
| Name | 2-(tert-butylsulfonylmethylsulfonyl)-2-methylpropane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.169g/cm3 |
|---|
| Boiling Point | 438.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H20O4S2 |
|---|
| Molecular Weight | 256.38300 |
|---|
| Flash Point | 271.1ºC |
|---|
| Exact Mass | 256.08000 |
|---|
| PSA | 85.04000 |
|---|
| LogP | 3.53210 |
|---|
| Index of Refraction | 1.471 |
|---|
| InChIKey | BLPNHXBJNOSJDS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)S(=O)(=O)CS(=O)(=O)C(C)(C)C |
|---|
Safety Information
Customs
| HS Code | 2904100000 |
|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Methylen-bis-tert.-butylsulfon |
| Bis(tert-Butylsulfonyl)methane |
| Bis-(tert-butylsulfonyl)-methan |
| bis-(1,1-dimethyl-ethanesulfonyl)-methane |
| propane,2,2'-(methylenedisulfonyl)bis[2-methyl |
| bis-(2-methyl-propane-2-sulfonyl)-methane |
| Bis-(1,1-dimethyl-aethansulfonyl)-methan |
