Introduction:Basic information about CAS 3393-96-2|4'-nitrobenzanilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4'-nitrobenzanilide |
|---|
| CAS Number | 3393-96-2 | Molecular Weight | 242.23000 |
|---|
| Density | 1.344g/cm3 | Boiling Point | 327ºC at 760mmHg |
|---|
| Molecular Formula | C13H10N2O3 | Melting Point | 202-204°C |
|---|
| MSDS | / | Flash Point | 151.5ºC |
|---|
Names
| Name | N-(4-nitrophenyl)benzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.344g/cm3 |
|---|
| Boiling Point | 327ºC at 760mmHg |
|---|
| Melting Point | 202-204°C |
|---|
| Molecular Formula | C13H10N2O3 |
|---|
| Molecular Weight | 242.23000 |
|---|
| Flash Point | 151.5ºC |
|---|
| Exact Mass | 242.06900 |
|---|
| PSA | 74.92000 |
|---|
| LogP | 3.44330 |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | GMGQGZYFQSCZCW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| p'-Nitrobenzanilide |
| N-(4-Nitrophenyl)benzamide |
| Benzanilide,4'-nitro |
| MFCD00024619 |
| N-Benzoyl-p-nitroaniline |
| 4-nitro-N-benzoylaniline |
| 4-benzamidonitrobenzene |
| 4'-NITROBENZANILIDE |
| EINECS 222-241-2 |