Introduction:Basic information about CAS 92028-21-2|3-Phenyl-4-anisidine hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Phenyl-4-anisidine hydrochloride |
|---|
| CAS Number | 92028-21-2 | Molecular Weight | 235.709 |
|---|
| Density | / | Boiling Point | 340.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14ClNO | Melting Point | 237-240ºC |
|---|
| MSDS | / | Flash Point | 166.2ºC |
|---|
Names
| Name | 4-methoxy-3-phenylaniline,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 340.1ºC at 760 mmHg |
|---|
| Melting Point | 237-240ºC |
|---|
| Molecular Formula | C13H14ClNO |
|---|
| Molecular Weight | 235.709 |
|---|
| Flash Point | 166.2ºC |
|---|
| Exact Mass | 235.076385 |
|---|
| PSA | 35.25000 |
|---|
| LogP | 4.32760 |
|---|
| InChIKey | ONIVGWWTHRIXHL-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(N)cc1-c1ccccc1.Cl |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2922299090 |
|---|
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 6-Methoxybiphenyl-3-amine hydrochloride (1:1) |
| 6-Methoxy-biphenyl-3-ylamin,Hydrochlorid |
| 6-methoxy-biphenyl-3-ylamine,hydrochloride |
| [1,1'-Biphenyl]-4-amine, 2-methoxy-, hydrochloride (1:1) |
| 2-Methoxy-4-biphenylamine hydrochloride (1:1) |
| 3-methoxy-4-phenylaniline,hydrochloride |
| 4-methoxy 3-phenylaniline hydrochloride |
| 3-Phenyl-4-anisidine hydrochloride |
| MFCD01630736 |
| 3-phenyl-p-anisidine hydrochloride |
| [1,1'-Biphenyl]-3-amine, 6-methoxy-, hydrochloride (1:1) |
| 3-phenyl-4-methoxyaniline hydrochloride |
| 2-Methoxybiphenyl-4-amine hydrochloride (1:1) |
| 6-Methoxy-3-biphenylamine hydrochloride (1:1) |