Introduction：Basic information about CAS 18470-33-2|3-(8-azabicyclo[3.2.1]oct-3-yl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(8-azabicyclo[3.2.1]oct-3-yl)benzoic acid |
|---|
| CAS Number | 18470-33-2 | Molecular Weight | 231.29000 |
|---|
| Density | 1.181g/cm3 | Boiling Point | 409.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H17NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.4ºC |
|---|
Names
| Name | 3-(8-azabicyclo[3.2.1]octan-3-yl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.181g/cm3 |
|---|
| Boiling Point | 409.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H17NO2 |
|---|
| Molecular Weight | 231.29000 |
|---|
| Flash Point | 201.4ºC |
|---|
| Exact Mass | 231.12600 |
|---|
| PSA | 49.33000 |
|---|
| LogP | 2.71160 |
|---|
| Vapour Pressure | 1.94E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | HRTCUJBTNCFSIO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc(C2CC3CCC(C2)N3)c1 |
|---|
Synonyms
| Nortropacocaine |
| O-Benzoylnortropine |
| 3endo-Benzoyloxy-nortropan |
| 3endo-benzoyloxy-nortropane |
