Introduction：Basic information about CAS 78371-66-1|Bucromarone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bucromarone |
|---|
| CAS Number | 78371-66-1 | Molecular Weight | 463.60800 |
|---|
| Density | 1.101g/cm3 | Boiling Point | 596.4ºC at 760 mmHg |
|---|
| Molecular Formula | C29H37NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 314.5ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.101g/cm3 |
|---|
| Boiling Point | 596.4ºC at 760 mmHg |
|---|
| Molecular Formula | C29H37NO4 |
|---|
| Molecular Weight | 463.60800 |
|---|
| Flash Point | 314.5ºC |
|---|
| Exact Mass | 463.27200 |
|---|
| PSA | 59.75000 |
|---|
| LogP | 6.31190 |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | DYGLNTZLBQBOPT-UHFFFAOYSA-N |
|---|
| SMILES | CCCCN(CCCC)CCCOc1c(C)cc(C(=O)c2cc(=O)c3ccccc3o2)cc1C |
|---|
