Introduction：Basic information about CAS 342889-39-8|3'-Chloro-2'-fluoro-4-biphenylcarbaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3'-Chloro-2'-fluoro-4-biphenylcarbaldehyde |
|---|
| CAS Number | 342889-39-8 | Molecular Weight | 234.653 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 352.2±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H8ClFO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.8±25.1 °C |
|---|
Names
| Name | 4-(3-Chloro-2-fluorophenyl)benzaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 352.2±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H8ClFO |
|---|
| Molecular Weight | 234.653 |
|---|
| Flash Point | 166.8±25.1 °C |
|---|
| Exact Mass | 234.024765 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.47 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.600 |
|---|
| InChIKey | LPIFQHGQMIRTBE-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1ccc(-c2ccc3c(c2)OCO3)cc1 |
|---|
Synonyms
| 4-(5-Chloro-2-fluorophenyl)benzaldehyde |
| 4-(4-Chloro-2-fluorophenyl)benzaldehyde |
| 3'-Chloro-2'-fluoro-4-biphenylcarbaldehyde |
| 4-(Benzo[1,3]dioxol-5-yl)benzaldehyde |
| Benzaldehyde,4-(1,3-benzodioxol-5-yl) |
| 4-(1,3-Benzodioxol-5-yl)-benzaldehyde |
| 4-formyl-3',4'-methylenedioxybiphenyl |
| [1,1'-Biphenyl]-4-carboxaldehyde, 3'-chloro-2'-fluoro- |
