Introduction:Basic information about CAS 82190-92-9|Flotrenizine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Flotrenizine |
|---|
| CAS Number | 82190-92-9 | Molecular Weight | 492.64300 |
|---|
| Density | 1.131g/cm3 | Boiling Point | 591.1ºC at 760 mmHg |
|---|
| Molecular Formula | C31H38F2N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 311.3ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.131g/cm3 |
|---|
| Boiling Point | 591.1ºC at 760 mmHg |
|---|
| Molecular Formula | C31H38F2N2O |
|---|
| Molecular Weight | 492.64300 |
|---|
| Flash Point | 311.3ºC |
|---|
| Exact Mass | 492.29500 |
|---|
| PSA | 26.71000 |
|---|
| LogP | 6.35890 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | DWUQCHRDSFIOAG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccc(C(O)CCCN2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1 |
|---|