Introduction:Basic information about CAS 78410-57-8|Ociltide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ociltide |
|---|
| CAS Number | 78410-57-8 | Molecular Weight | 640.75000 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 1145.7ºC at 760 mmHg |
|---|
| Molecular Formula | C31H40N6O7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 646.7ºC |
|---|
Names
| Name | Ociltide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 1145.7ºC at 760 mmHg |
|---|
| Molecular Formula | C31H40N6O7S |
|---|
| Molecular Weight | 640.75000 |
|---|
| Flash Point | 646.7ºC |
|---|
| Exact Mass | 640.26800 |
|---|
| PSA | 234.12000 |
|---|
| LogP | 2.94580 |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | RQBSKKBNALPMSL-GMIDLEKQSA-N |
|---|
| SMILES | NC(Cc1ccc(O)cc1)C(=O)NC(CCCCNC=O)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NC1CCSC1=O |
|---|
Synonyms
| L-Tyr-N6-Formyl-D-Lys-Gly-L-Phe-(tetrahydro-2-oxothiophen-3-yl)-NH2 |
| HOE 825 |
| 2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-N-[2-[[1-(benzyl)-2-keto-2-[(2-ketotetrahydrothiophen-3-yl)amino]ethyl]amino]-2-keto-ethyl]-6-formamido-hexanamide |
| 2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-6-formamido-N-[2-oxo-2-[[1-oxo-1-[(2-oxothiolan-3-yl)amino]-3-phenylpropan-2-yl]amino]ethyl]hexanamide |
| 2-[[2-azanyl-3-(4-hydroxyphenyl)propanoyl]amino]-6-formamido-N-[2-oxo-2-[[1-oxo-1-[(2-oxothiolan-3-yl)amino]-3-phenyl-propan-2-yl]amino]ethyl]hexanamide |