Introduction：Basic information about CAS 28240-18-8|Pinolcaine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pinolcaine |
|---|
| CAS Number | 28240-18-8 | Molecular Weight | 351.48200 |
|---|
| Density | 1.07g/cm3 | Boiling Point | 446.8ºC at 760mmHg |
|---|
| Molecular Formula | C23H29NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 138.7ºC |
|---|
Names
| Name | 2-[(2R)-1-methylpiperidin-2-yl]propan-2-yl 2,2-diphenylacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.07g/cm3 |
|---|
| Boiling Point | 446.8ºC at 760mmHg |
|---|
| Molecular Formula | C23H29NO2 |
|---|
| Molecular Weight | 351.48200 |
|---|
| Flash Point | 138.7ºC |
|---|
| Exact Mass | 351.22000 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 4.56250 |
|---|
| Vapour Pressure | 3.53E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | FKFABDZLGKRECY-HXUWFJFHSA-N |
|---|
| SMILES | CN1CCCCC1C(C)(C)OC(=O)C(c1ccccc1)c1ccccc1 |
|---|
Synonyms
| UNII-S0U059XF2E |
| Pinolcaine |
| Pinolcaine [INN] |
| D-(+)-1-Methyl-1-(1-methyl-2-piperidyl)ethyl diphenylacetate |
