Introduction：Basic information about CAS 78208-13-6|Zolenzepine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Zolenzepine |
|---|
| CAS Number | 78208-13-6 | Molecular Weight | 368.43300 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 560.5ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24N6O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 292.8ºC |
|---|
Names
| Name | 1,3-dimethyl-10-[2-(4-methylpiperazin-1-yl)acetyl]-5H-pyrazolo[3,4-c][1,5]benzodiazepin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 560.5ºC at 760 mmHg |
|---|
| Molecular Formula | C19H24N6O2 |
|---|
| Molecular Weight | 368.43300 |
|---|
| Flash Point | 292.8ºC |
|---|
| Exact Mass | 368.19600 |
|---|
| PSA | 79.16000 |
|---|
| LogP | 0.85030 |
|---|
| Index of Refraction | 1.692 |
|---|
| InChIKey | OBVFNDZOAJBXJM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nn(C)c2c1N(C(=O)CN1CCN(C)CC1)c1ccccc1NC2=O |
|---|
Synonyms
| UNII-O0XJ4L38Z3 |
| Zolenzepine [INN] |
| 4,9-Dihydro-1,3-dimethyl-4-((4-methyl-1-piperazinyl)acetyl)pyrazolo(4,3-b)(1,5)benzodiazepin-10(1H)-one |
| Zolenzepine |
