Introduction：Basic information about CAS 65511-41-3|Nantradol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nantradol |
|---|
| CAS Number | 65511-41-3 | Molecular Weight | 437.57100 |
|---|
| Density | 1.122g/cm3 | Boiling Point | 591.7ºC at 760 mmHg |
|---|
| Molecular Formula | C27H35NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 311.7ºC |
|---|
Names
| Name | [9-hydroxy-6-methyl-3-(5-phenylpentan-2-yloxy)-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-1-yl] acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.122g/cm3 |
|---|
| Boiling Point | 591.7ºC at 760 mmHg |
|---|
| Molecular Formula | C27H35NO4 |
|---|
| Molecular Weight | 437.57100 |
|---|
| Flash Point | 311.7ºC |
|---|
| Exact Mass | 437.25700 |
|---|
| PSA | 67.79000 |
|---|
| LogP | 5.59870 |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | FFVXQGMUHIJQAO-KXUCESEGSA-N |
|---|
| SMILES | CC(=O)Oc1cc(OC(C)CCCc2ccccc2)cc2c1C1CC(O)CCC1C(C)N2 |
|---|
Synonyms
| (-)-5,6,6abeta,7,8,9alpha,10,10aalpha-Octahydro-9beta-hydroxy-6beta-methyl-3-(1-methyl-4-phenylbutoxy)-1-phenanthridinyl acetat |
| C27H35NO4 |
| Nantrodolum |
| 6-Methyl-3-(1-methyl-4-phenylbutoxy)-5,6,6a,7,8,9,10,10a-octahydro-1,9-phenanthridinediol acetate |
| 1,9-Phenanthridinediol,5,6,6a,7,8,9,10,10a-octahydro-6-methyl-3-(1-methyl-4-phenylbutoxy)-,1-acetate |
| Nantradol |
| d-Nantradol |
| Nantradol [INN] |
