Introduction：Basic information about CAS 49561-92-4|5,6-dimethyl-2-nitroindene-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-dimethyl-2-nitroindene-1,3-dione |
|---|
| CAS Number | 49561-92-4 | Molecular Weight | 219.19300 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 445.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234.2ºC |
|---|
Names
| Name | 5,6-dimethyl-2-nitroindene-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 445.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9NO4 |
|---|
| Molecular Weight | 219.19300 |
|---|
| Flash Point | 234.2ºC |
|---|
| Exact Mass | 219.05300 |
|---|
| PSA | 79.96000 |
|---|
| LogP | 1.85090 |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | KMQFWCXRCDQFFQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc2c(cc1C)C(=O)C([N+](=O)[O-])C2=O |
|---|
Synonyms
| Nivimedona [INN-Spanish] |
| Nivimedonum |
| Nivimedonum [INN-Latin] |
| Nivimedone [INN:BAN] |
| 5,6-Dimethyl-2-nitroindan-1,3-dion |
| 1H-Indene-1,3(2H)-dione,5,6-dimethyl-2-nitro |
| 5,6-dimethyl-2-nitro-1H-indene-1,3(2H)-dione |
| Nivimedone |
| 5,6-Dimethyl-2-nitroindandion |
| 5,6-dimethyl-2-nitroindane-1,3-dione |
| Nivimedona |
