Introduction：Basic information about CAS 475250-52-3|4-Methoxybenzylboronic acid pinacol ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Methoxybenzylboronic acid pinacol ester |
|---|
| CAS Number | 475250-52-3 | Molecular Weight | 248.126 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 311.2±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H21BO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.0±23.2 °C |
|---|
Names
| Name | 2-(4-Methoxybenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 311.2±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H21BO3 |
|---|
| Molecular Weight | 248.126 |
|---|
| Flash Point | 142.0±23.2 °C |
|---|
| Exact Mass | 248.158371 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 3.13550 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.490 |
|---|
| InChIKey | HPNLRRQVSZVKHY-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CB2OC(C)(C)C(C)(C)O2)cc1 |
|---|
Synonyms
| 1,3,2-Dioxaborolane, 2-[(4-methoxyphenyl)methyl]-4,4,5,5-tetramethyl- |
| 2-(4-Methoxybenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| MFCD10698526 |
| 2-[(4-methoxyphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| 4-Methoxybenzylboronic acid pinacol ester |
