Introduction：Basic information about CAS 3393-77-9|Bis(4-methoxyphenyl) sulfide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(4-methoxyphenyl) sulfide |
|---|
| CAS Number | 3393-77-9 | Molecular Weight | 246.325 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 396.9±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H14O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.9±23.7 °C |
|---|
Names
| Name | Bis(4-methoxyphenyl)sulfane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 396.9±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H14O2S |
|---|
| Molecular Weight | 246.325 |
|---|
| Flash Point | 193.9±23.7 °C |
|---|
| Exact Mass | 246.071457 |
|---|
| PSA | 43.76000 |
|---|
| LogP | 4.34 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | UKHKZGJCPDWXQY-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Sc2ccc(OC)cc2)cc1 |
|---|
| Storage condition | 2-8°C, stored under nitrogen |
|---|
Synonyms
| 4,4'-Dimethoxy diphenyl sulfide |
| Bis(4-methoxyphenyl) sulfide |
| 1,1'-thio-bis[4-methoxy]-benzene |
| 4,4-Thiodianisole |
| 4-methylphenyl 4-methoxyphenyl sulfide |
| 1,1'-Sulfanediylbis(4-methoxybenzene) |
| Benzene, 1,1'-thiobis[4-methoxy- |
| 4-(4'-methoxyphenyl)sulfanylanisole |
