Introduction：Basic information about CAS 7147-33-3|Butanedioic acid,2-oxo-3-phenyl-, 1,4-diethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butanedioic acid,2-oxo-3-phenyl-, 1,4-diethyl ester |
|---|
| CAS Number | 7147-33-3 | Molecular Weight | 264.27400 |
|---|
| Density | 1.168g/cm3 | Boiling Point | 367.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161ºC |
|---|
Names
| Name | diethyl 2-oxo-3-phenylbutanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.168g/cm3 |
|---|
| Boiling Point | 367.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16O5 |
|---|
| Molecular Weight | 264.27400 |
|---|
| Flash Point | 161ºC |
|---|
| Exact Mass | 264.10000 |
|---|
| PSA | 69.67000 |
|---|
| LogP | 1.46550 |
|---|
| Index of Refraction | 1.505 |
|---|
| InChIKey | KSOKJSQCASQKMW-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)C(C(=O)OCC)c1ccccc1 |
|---|
Synonyms
| Phenyl-oxalessigsaeure-diaethylester |
| Diaethyl-1-oxo-2-phenylsuccinat |
| 2-oxo-3-phenyl-succinic acid diethyl ester |
| Phenylessigsaeureethoxalylethylester |
| 2-oxo-3-phenylbutanedioic acid diethyl ester |
| oxo-phenyl-succinic acid diethyl ester |
| diethyl 2-oxo-3-phenylsuccinate |
